About 2-oxo-N,2-diphenylethanimine oxide
2-oxo-N,2-diphenylethanimine oxide (PubChem CID 11085465) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-oxo-N,2-diphenylethanimine oxide.
Molecular Properties
| Compound Name | 2-oxo-N,2-diphenylethanimine oxide |
| PubChem CID | 11085465 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-oxo-N,2-diphenylethanimine oxide |
| SMILES | O=C(/C=[N+](\[O-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11NO2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-11H/b15-11- |
| InChIKey | VXNWOQBKIZBCOB-PTNGSMBKSA-N |
| XLogP | 2.78 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-N,2-diphenylethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N,2-diphenylethanimine oxide?
The IUPAC name of 2-oxo-N,2-diphenylethanimine oxide (CID 11085465) is 2-oxo-N,2-diphenylethanimine oxide.
What is the SMILES notation for 2-oxo-N,2-diphenylethanimine oxide?
The canonical SMILES for 2-oxo-N,2-diphenylethanimine oxide is O=C(/C=[N+](\[O-])c1ccccc1)c1ccccc1.
What is the InChIKey of 2-oxo-N,2-diphenylethanimine oxide?
The InChIKey is VXNWOQBKIZBCOB-PTNGSMBKSA-N. The full InChI is InChI=1S/C14H11NO2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-11H/b15-11-.
What are the key properties of 2-oxo-N,2-diphenylethanimine oxide?
2-oxo-N,2-diphenylethanimine oxide has a molecular weight of 225.25 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N,2-diphenylethanimine oxide is sourced from PubChem (CID 11085465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).