C15H21N3O2 — CID 110854880
oxan-2-yl-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 110854880) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is oxan-2-yl-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | oxan-2-yl-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110854880 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | oxan-2-yl-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(C1CCCCO1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C15H21N3O2/c19-15(13-5-2-4-12-20-13)18-10-8-17(9-11-18)14-6-1-3-7-16-14/h1,3,6-7,13H,2,4-5,8-12H2 |
| InChIKey | URVJCIGKMMJXRU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |