About CID 11085528
CID 11085528 (PubChem CID 11085528) has the molecular formula C7H11Cl2NTi-
and a molecular weight of 227.95 g/mol.
Molecular Properties
| Compound Name | CID 11085528 |
| PubChem CID | 11085528 |
| Molecular Formula | C7H11Cl2NTi- |
| Molecular Weight | 227.95 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | — |
| SMILES | C[N-]C.Cl[Ti]Cl.[CH]1C=CC=C1 |
| InChI | InChI=1S/C5H5.C2H6N.2ClH.Ti/c1-2-4-5-3-1;1-3-2;;;/h1-5H;1-2H3;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | SSEBXEPFBNEKDU-UHFFFAOYSA-L |
| XLogP | 3.31 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.95 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11085528 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11085528?
The IUPAC name of CID 11085528 (CID 11085528) is not available.
What is the SMILES notation for CID 11085528?
The canonical SMILES for CID 11085528 is C[N-]C.Cl[Ti]Cl.[CH]1C=CC=C1.
What is the InChIKey of CID 11085528?
The InChIKey is SSEBXEPFBNEKDU-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H5.C2H6N.2ClH.Ti/c1-2-4-5-3-1;1-3-2;;;/h1-5H;1-2H3;2*1H;/q;-1;;;+2/p-2.
What are the key properties of CID 11085528?
CID 11085528 has a molecular weight of 227.95 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11085528 is sourced from PubChem (CID 11085528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).