About N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide
N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide (PubChem CID 1108555) has the molecular formula C25H23N3O3
and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide |
| PubChem CID | 1108555 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)c3cccc4c(N5CCCCC5)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-16(29)26-17-8-10-18(11-9-17)28-24(30)20-7-5-6-19-22(27-14-3-2-4-15-27)13-12-21(23(19)20)25(28)31/h5-13H,2-4,14-15H2,1H3,(H,26,29) |
| InChIKey | VYYNBYGHSVOKPU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide?
The IUPAC name of N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide (CID 1108555) is N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide.
What is the SMILES notation for N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide?
The canonical SMILES for N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide is CC(=O)Nc1ccc(N2C(=O)c3cccc4c(N5CCCCC5)ccc(c34)C2=O)cc1.
What is the InChIKey of N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide?
The InChIKey is VYYNBYGHSVOKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O3/c1-16(29)26-17-8-10-18(11-9-17)28-24(30)20-7-5-6-19-22(27-14-3-2-4-15-27)13-12-21(23(19)20)25(28)31/h5-13H,2-4,14-15H2,1H3,(H,26,29).
What are the key properties of N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide?
N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide has a molecular weight of 413.48 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)phenyl]acetamide is sourced from PubChem (CID 1108555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).