C18H23N3O — CID 110855772
(4-benzylpiperidin-1-yl)-(4,5-dimethyl-1H-pyrazol-3-yl)methanone (PubChem CID 110855772) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(4,5-dimethyl-1H-pyrazol-3-yl)methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-(4,5-dimethyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 110855772 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(4,5-dimethyl-1H-pyrazol-3-yl)methanone |
| SMILES | Cc1[nH]nc(C(=O)N2CCC(Cc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C18H23N3O/c1-13-14(2)19-20-17(13)18(22)21-10-8-16(9-11-21)12-15-6-4-3-5-7-15/h3-7,16H,8-12H2,1-2H3,(H,19,20) |
| InChIKey | OVMCJBFYCPWZLI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |