C11H16N2O2 — CID 110855862
(2-ethylpiperidin-1-yl)-(1,2-oxazol-4-yl)methanone (PubChem CID 110855862) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2-ethylpiperidin-1-yl)-(1,2-oxazol-4-yl)methanone.
| Compound Name | (2-ethylpiperidin-1-yl)-(1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 110855862 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (2-ethylpiperidin-1-yl)-(1,2-oxazol-4-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)c1cnoc1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-10-5-3-4-6-13(10)11(14)9-7-12-15-8-9/h7-8,10H,2-6H2,1H3 |
| InChIKey | WNYBQPYJGYUKPL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |