About 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one
3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one (PubChem CID 110855975) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one.
Molecular Properties
| Compound Name | 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one |
| PubChem CID | 110855975 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one |
| SMILES | CCC1CCCCN1C(=O)c1c(C)cc(C)n(C)c1=O |
| InChI | InChI=1S/C16H24N2O2/c1-5-13-8-6-7-9-18(13)16(20)14-11(2)10-12(3)17(4)15(14)19/h10,13H,5-9H2,1-4H3 |
| InChIKey | MCNXKKTUAFUWON-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one?
The IUPAC name of 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one (CID 110855975) is 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one.
What is the SMILES notation for 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one?
The canonical SMILES for 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one is CCC1CCCCN1C(=O)c1c(C)cc(C)n(C)c1=O.
What is the InChIKey of 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one?
The InChIKey is MCNXKKTUAFUWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-5-13-8-6-7-9-18(13)16(20)14-11(2)10-12(3)17(4)15(14)19/h10,13H,5-9H2,1-4H3.
What are the key properties of 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one?
3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one has a molecular weight of 276.38 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylpiperidine-1-carbonyl)-1,4,6-trimethylpyridin-2-one is sourced from PubChem (CID 110855975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).