C17H26 — CID 11085600
(1R,5S,7S)-7-[(3E)-hexa-3,5-dienyl]-1-prop-1-en-2-ylbicyclo[3.2.1]octane (PubChem CID 11085600) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is (1R,5S,7S)-7-[(3E)-hexa-3,5-dienyl]-1-prop-1-en-2-ylbicyclo[3.2.1]octane.
| Compound Name | (1R,5S,7S)-7-[(3E)-hexa-3,5-dienyl]-1-prop-1-en-2-ylbicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11085600 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | (1R,5S,7S)-7-[(3E)-hexa-3,5-dienyl]-1-prop-1-en-2-ylbicyclo[3.2.1]octane |
| SMILES | C=C/C=C/CC[C@H]1C[C@@H]2CCC[C@@]1(C(=C)C)C2 |
| InChI | InChI=1S/C17H26/c1-4-5-6-7-10-16-12-15-9-8-11-17(16,13-15)14(2)3/h4-6,15-16H,1-2,7-13H2,3H3/b6-5+/t15-,16-,17-/m0/s1 |
| InChIKey | LMBNTKONCMLARK-WEFMNJOJSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|