About pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone
pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone (PubChem CID 11085814) has the molecular formula C11H11NOS2
and a molecular weight of 237.35 g/mol. Its IUPAC name is pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone.
Molecular Properties
| Compound Name | pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone |
| PubChem CID | 11085814 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone |
| SMILES | O=C(c1cc2sccc2s1)N1CCCC1 |
| InChI | InChI=1S/C11H11NOS2/c13-11(12-4-1-2-5-12)10-7-9-8(15-10)3-6-14-9/h3,6-7H,1-2,4-5H2 |
| InChIKey | JEMRJZFMPOMSBI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone?
The IUPAC name of pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone (CID 11085814) is pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone.
What is the SMILES notation for pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone?
The canonical SMILES for pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone is O=C(c1cc2sccc2s1)N1CCCC1.
What is the InChIKey of pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone?
The InChIKey is JEMRJZFMPOMSBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS2/c13-11(12-4-1-2-5-12)10-7-9-8(15-10)3-6-14-9/h3,6-7H,1-2,4-5H2.
What are the key properties of pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone?
pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone has a molecular weight of 237.35 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone is sourced from PubChem (CID 11085814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).