C20H22N2O2 — CID 110858427
N-(2-tert-butylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 110858427) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 110858427 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-(2-tert-butylphenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C20H22N2O2/c1-20(2,3)15-6-4-5-7-17(15)22-19(24)14-8-10-16-13(12-14)9-11-18(23)21-16/h4-8,10,12H,9,11H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | DGRJDKKYIGMMCZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |