C12H12ClN3O — CID 110858828
N-(3-chlorophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide (PubChem CID 110858828) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110858828 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-(3-chlorophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)Nc2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C12H12ClN3O/c1-7-8(2)15-16-11(7)12(17)14-10-5-3-4-9(13)6-10/h3-6H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | JBQQMEXIZWLMQG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |