C12H9ClFN3O2 — CID 110859395
N-(3-chloro-4-fluorophenyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 110859395) has the molecular formula C12H9ClFN3O2 and a molecular weight of 281.67 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110859395 |
| Molecular Formula | C12H9ClFN3O2 |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)Nc2ccc(F)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H9ClFN3O2/c1-6-15-5-8(11(18)16-6)12(19)17-7-2-3-10(14)9(13)4-7/h2-5H,1H3,(H,17,19)(H,15,16,18) |
| InChIKey | XXJQUAKKDSYJEP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |