C18H17FN2O3 — CID 110860582
N-(2,4-dimethoxyphenyl)-6-fluoro-2-methyl-1H-indole-3-carboxamide (PubChem CID 110860582) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6-fluoro-2-methyl-1H-indole-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-6-fluoro-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 110860582 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6-fluoro-2-methyl-1H-indole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(C)[nH]c3cc(F)ccc23)c(OC)c1 |
| InChI | InChI=1S/C18H17FN2O3/c1-10-17(13-6-4-11(19)8-15(13)20-10)18(22)21-14-7-5-12(23-2)9-16(14)24-3/h4-9,20H,1-3H3,(H,21,22) |
| InChIKey | IGORPLMQJCLTNP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |