C14H13N3O3S — CID 110860630
N-(2,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 110860630) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 110860630 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2csc3nccn23)c(OC)c1 |
| InChI | InChI=1S/C14H13N3O3S/c1-19-9-3-4-10(12(7-9)20-2)16-13(18)11-8-21-14-15-5-6-17(11)14/h3-8H,1-2H3,(H,16,18) |
| InChIKey | QDWNVTZACJOAPL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |