C21H22BrN3O2S — CID 1108607
N-(4-bromophenyl)-2-[[(4S)-3-cyano-4,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]acetamide (PubChem CID 1108607) has the molecular formula C21H22BrN3O2S and a molecular weight of 460.40 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[[(4S)-3-cyano-4,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[[(4S)-3-cyano-4,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1108607 |
| Molecular Formula | C21H22BrN3O2S |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-(4-bromophenyl)-2-[[(4S)-3-cyano-4,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]sulfanyl]acetamide |
| SMILES | C[C@@H]1C(C#N)=C(SCC(=O)Nc2ccc(Br)cc2)NC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H22BrN3O2S/c1-12-15(10-23)20(25-16-8-21(2,3)9-17(26)19(12)16)28-11-18(27)24-14-6-4-13(22)5-7-14/h4-7,12,25H,8-9,11H2,1-3H3,(H,24,27)/t12-/m1/s1 |
| InChIKey | ZWPFZISKQUHBGI-GFCCVEGCSA-N |
| XLogP | 4.74 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |