C13H13NO2S — CID 11086093
methyl 5-phenyl-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate (PubChem CID 11086093) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is methyl 5-phenyl-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate.
| Compound Name | methyl 5-phenyl-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate |
|---|---|
| PubChem CID | 11086093 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | methyl 5-phenyl-4-thia-6-azaspiro[2.4]hept-5-ene-7-carboxylate |
| SMILES | COC(=O)C1N=C(c2ccccc2)SC12CC2 |
| InChI | InChI=1S/C13H13NO2S/c1-16-12(15)10-13(7-8-13)17-11(14-10)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | GXMZHLZNISDLQP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |