About N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide
N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 110861523) has the molecular formula C14H12N4O2S
and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
| PubChem CID | 110861523 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2csc3nccn23)cc1 |
| InChI | InChI=1S/C14H12N4O2S/c1-9(19)16-10-2-4-11(5-3-10)17-13(20)12-8-21-14-15-6-7-18(12)14/h2-8H,1H3,(H,16,19)(H,17,20) |
| InChIKey | HZSGQTTWRSUBSI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide?
The IUPAC name of N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide (CID 110861523) is N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide.
What is the SMILES notation for N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide?
The canonical SMILES for N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide is CC(=O)Nc1ccc(NC(=O)c2csc3nccn23)cc1.
What is the InChIKey of N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide?
The InChIKey is HZSGQTTWRSUBSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2S/c1-9(19)16-10-2-4-11(5-3-10)17-13(20)12-8-21-14-15-6-7-18(12)14/h2-8H,1H3,(H,16,19)(H,17,20).
What are the key properties of N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide?
N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide has a molecular weight of 300.34 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetamidophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide is sourced from PubChem (CID 110861523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).