C15H17N3O3 — CID 110862361
4-methyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-5-carboxamide (PubChem CID 110862361) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-methyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 110862361 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-methyl-N-(2-morpholin-4-ylphenyl)-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C15H17N3O3/c1-11-10-16-21-14(11)15(19)17-12-4-2-3-5-13(12)18-6-8-20-9-7-18/h2-5,10H,6-9H2,1H3,(H,17,19) |
| InChIKey | HYLMDVDKZYZRBY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |