C15H12O4 — CID 11086357
14,14-dimethyl-12,15-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),3,5,7-tetraene-2,9-dione (PubChem CID 11086357) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 14,14-dimethyl-12,15-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),3,5,7-tetraene-2,9-dione.
| Compound Name | 14,14-dimethyl-12,15-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),3,5,7-tetraene-2,9-dione |
|---|---|
| PubChem CID | 11086357 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 14,14-dimethyl-12,15-dioxatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),3,5,7-tetraene-2,9-dione |
| SMILES | CC1(C)OC2=C(C(=O)c3ccccc3C2=O)C2OC21 |
| InChI | InChI=1S/C15H12O4/c1-15(2)14-13(18-14)9-10(16)7-5-3-4-6-8(7)11(17)12(9)19-15/h3-6,13-14H,1-2H3 |
| InChIKey | STGAGSZHQWTSQD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|