C15H19NO3S — CID 110863895
(1,1-dioxothian-3-yl)-(2-methyl-2,3-dihydroindol-1-yl)methanone (PubChem CID 110863895) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (1,1-dioxothian-3-yl)-(2-methyl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (1,1-dioxothian-3-yl)-(2-methyl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110863895 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (1,1-dioxothian-3-yl)-(2-methyl-2,3-dihydroindol-1-yl)methanone |
| SMILES | CC1Cc2ccccc2N1C(=O)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19NO3S/c1-11-9-12-5-2-3-7-14(12)16(11)15(17)13-6-4-8-20(18,19)10-13/h2-3,5,7,11,13H,4,6,8-10H2,1H3 |
| InChIKey | UUOHKIUCERPTEF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |