C12H9Cl2N3O — CID 110863958
N-(3,4-dichlorophenyl)-4-methylpyrimidine-5-carboxamide (PubChem CID 110863958) has the molecular formula C12H9Cl2N3O and a molecular weight of 282.13 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110863958 |
| Molecular Formula | C12H9Cl2N3O |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncncc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl2N3O/c1-7-9(5-15-6-16-7)12(18)17-8-2-3-10(13)11(14)4-8/h2-6H,1H3,(H,17,18) |
| InChIKey | ITGPPWUHULUHQZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |