C11H15BrO2 — CID 11086454
(3S,3aR,6S,8aS)-3-bromo-3,6-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one (PubChem CID 11086454) has the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. Its IUPAC name is (3S,3aR,6S,8aS)-3-bromo-3,6-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one.
| Compound Name | (3S,3aR,6S,8aS)-3-bromo-3,6-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 11086454 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | (3S,3aR,6S,8aS)-3-bromo-3,6-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
| SMILES | C[C@@H]1C=C[C@@H]2OC(=O)[C@@](C)(Br)[C@@H]2CC1 |
| InChI | InChI=1S/C11H15BrO2/c1-7-3-5-8-9(6-4-7)14-10(13)11(8,2)12/h4,6-9H,3,5H2,1-2H3/t7-,8+,9-,11-/m0/s1 |
| InChIKey | BHVQIRNJMYENHZ-DKIAZLNASA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|