About [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate
[(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate (PubChem CID 11086515) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate.
Molecular Properties
| Compound Name | [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate |
| PubChem CID | 11086515 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CCC[C@@]1(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O2/c1-13-6-8-15(9-7-13)17(4)11-5-10-16(17,3)12-19-14(2)18/h6-9H,5,10-12H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | ZHOBFAUFESISCM-SJORKVTESA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate?
The IUPAC name of [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate (CID 11086515) is [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate.
What is the SMILES notation for [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate?
The canonical SMILES for [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate is CC(=O)OC[C@@]1(C)CCC[C@@]1(C)c1ccc(C)cc1.
What is the InChIKey of [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate?
The InChIKey is ZHOBFAUFESISCM-SJORKVTESA-N. The full InChI is InChI=1S/C17H24O2/c1-13-6-8-15(9-7-13)17(4)11-5-10-16(17,3)12-19-14(2)18/h6-9H,5,10-12H2,1-4H3/t16-,17+/m1/s1.
What are the key properties of [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate?
[(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate has a molecular weight of 260.38 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-1,2-dimethyl-2-(4-methylphenyl)cyclopentyl]methyl acetate is sourced from PubChem (CID 11086515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).