C10H13BrO3 — CID 11086529
[(2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methanol (PubChem CID 11086529) has the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. Its IUPAC name is [(2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methanol.
| Compound Name | [(2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methanol |
|---|---|
| PubChem CID | 11086529 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | [(2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methanol |
| SMILES | OC[C@H]1C[C@H]2O[C@H](C=C=CBr)C[C@H]2O1 |
| InChI | InChI=1S/C10H13BrO3/c11-3-1-2-7-4-9-10(13-7)5-8(6-12)14-9/h2-3,7-10,12H,4-6H2/t1?,7-,8-,9-,10-/m1/s1 |
| InChIKey | XFGIUYCELYNGNR-SAOMAXPESA-N |
| XLogP | 1.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |