About (2E)-1-iodo-3,7-dimethylocta-2,6-diene
(2E)-1-iodo-3,7-dimethylocta-2,6-diene (PubChem CID 11086623) has the molecular formula C10H17I
and a molecular weight of 264.15 g/mol. Its IUPAC name is (2E)-1-iodo-3,7-dimethylocta-2,6-diene.
Molecular Properties
| Compound Name | (2E)-1-iodo-3,7-dimethylocta-2,6-diene |
| PubChem CID | 11086623 |
| Molecular Formula | C10H17I |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (2E)-1-iodo-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CI |
| InChI | InChI=1S/C10H17I/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | UIDURKICBDKTRR-JXMROGBWSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-iodo-3,7-dimethylocta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-iodo-3,7-dimethylocta-2,6-diene?
The IUPAC name of (2E)-1-iodo-3,7-dimethylocta-2,6-diene (CID 11086623) is (2E)-1-iodo-3,7-dimethylocta-2,6-diene.
What is the SMILES notation for (2E)-1-iodo-3,7-dimethylocta-2,6-diene?
The canonical SMILES for (2E)-1-iodo-3,7-dimethylocta-2,6-diene is CC(C)=CCC/C(C)=C/CI.
What is the InChIKey of (2E)-1-iodo-3,7-dimethylocta-2,6-diene?
The InChIKey is UIDURKICBDKTRR-JXMROGBWSA-N. The full InChI is InChI=1S/C10H17I/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+.
What are the key properties of (2E)-1-iodo-3,7-dimethylocta-2,6-diene?
(2E)-1-iodo-3,7-dimethylocta-2,6-diene has a molecular weight of 264.15 g/mol, XLogP of 4.11, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-iodo-3,7-dimethylocta-2,6-diene is sourced from PubChem (CID 11086623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).