About 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol
6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol (PubChem CID 11086655) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol |
| PubChem CID | 11086655 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol |
| SMILES | C/C=C/C=C/CCC1CCC(OCC(C)C)=CC1O |
| InChI | InChI=1S/C17H28O2/c1-4-5-6-7-8-9-15-10-11-16(12-17(15)18)19-13-14(2)3/h4-7,12,14-15,17-18H,8-11,13H2,1-3H3/b5-4+,7-6+ |
| InChIKey | CFYHBAXXXWBBRF-YTXTXJHMSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol?
The IUPAC name of 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol (CID 11086655) is 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol.
What is the SMILES notation for 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol?
The canonical SMILES for 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol is C/C=C/C=C/CCC1CCC(OCC(C)C)=CC1O.
What is the InChIKey of 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol?
The InChIKey is CFYHBAXXXWBBRF-YTXTXJHMSA-N. The full InChI is InChI=1S/C17H28O2/c1-4-5-6-7-8-9-15-10-11-16(12-17(15)18)19-13-14(2)3/h4-7,12,14-15,17-18H,8-11,13H2,1-3H3/b5-4+,7-6+.
What are the key properties of 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol?
6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol has a molecular weight of 264.41 g/mol, XLogP of 4.23, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3E,5E)-hepta-3,5-dienyl]-3-(2-methylpropoxy)cyclohex-2-en-1-ol is sourced from PubChem (CID 11086655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).