C12H15BrO2 — CID 11086854
(3aR,8bS)-5-bromo-8-methyl-3,3a,4,5,6,7,8,8b-octahydroindeno[1,2-b]furan-2-one (PubChem CID 11086854) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is (3aR,8bS)-5-bromo-8-methyl-3,3a,4,5,6,7,8,8b-octahydroindeno[1,2-b]furan-2-one.
| Compound Name | (3aR,8bS)-5-bromo-8-methyl-3,3a,4,5,6,7,8,8b-octahydroindeno[1,2-b]furan-2-one |
|---|---|
| PubChem CID | 11086854 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (3aR,8bS)-5-bromo-8-methyl-3,3a,4,5,6,7,8,8b-octahydroindeno[1,2-b]furan-2-one |
| SMILES | CC1CCC(Br)C2=C1[C@H]1OC(=O)C[C@H]1C2 |
| InChI | InChI=1S/C12H15BrO2/c1-6-2-3-9(13)8-4-7-5-10(14)15-12(7)11(6)8/h6-7,9,12H,2-5H2,1H3/t6?,7-,9?,12+/m1/s1 |
| InChIKey | DIRQSJURWTYTIC-PHNZVPJQSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|