About 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene
1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene (PubChem CID 11086921) has the molecular formula C13H17ClO2S
and a molecular weight of 272.80 g/mol. Its IUPAC name is 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene |
| PubChem CID | 11086921 |
| Molecular Formula | C13H17ClO2S |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene |
| SMILES | COC[C@H]1CCC[C@H]1S(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H17ClO2S/c1-16-9-10-5-4-8-12(10)17(15)13-7-3-2-6-11(13)14/h2-3,6-7,10,12H,4-5,8-9H2,1H3/t10-,12-,17?/m1/s1 |
| InChIKey | SGZLJWVJOSKBEC-LYILECPJSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene?
The IUPAC name of 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene (CID 11086921) is 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene.
What is the SMILES notation for 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene?
The canonical SMILES for 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene is COC[C@H]1CCC[C@H]1S(=O)c1ccccc1Cl.
What is the InChIKey of 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene?
The InChIKey is SGZLJWVJOSKBEC-LYILECPJSA-N. The full InChI is InChI=1S/C13H17ClO2S/c1-16-9-10-5-4-8-12(10)17(15)13-7-3-2-6-11(13)14/h2-3,6-7,10,12H,4-5,8-9H2,1H3/t10-,12-,17?/m1/s1.
What are the key properties of 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene?
1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene has a molecular weight of 272.80 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-[(1R,2R)-2-(methoxymethyl)cyclopentyl]sulfinylbenzene is sourced from PubChem (CID 11086921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).