About [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate (PubChem CID 11087059) has the molecular formula C12H11N3O3S
and a molecular weight of 277.31 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate |
| PubChem CID | 11087059 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate |
| SMILES | CCC(=O)Oc1cccnc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H11N3O3S/c1-2-9(16)18-8-4-3-5-13-10(8)11(17)15-12-14-6-7-19-12/h3-7H,2H2,1H3,(H,14,15,17) |
| InChIKey | YGXRHUUAHDMSSQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate?
The IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate (CID 11087059) is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate.
What is the SMILES notation for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate?
The canonical SMILES for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate is CCC(=O)Oc1cccnc1C(=O)Nc1nccs1.
What is the InChIKey of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate?
The InChIKey is YGXRHUUAHDMSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O3S/c1-2-9(16)18-8-4-3-5-13-10(8)11(17)15-12-14-6-7-19-12/h3-7H,2H2,1H3,(H,14,15,17).
What are the key properties of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate?
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate has a molecular weight of 277.31 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] propanoate is sourced from PubChem (CID 11087059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).