About methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate
methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate (PubChem CID 110870856) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate |
| PubChem CID | 110870856 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate |
| SMILES | COC(=O)Nc1cccc2c1OCC2 |
| InChI | InChI=1S/C10H11NO3/c1-13-10(12)11-8-4-2-3-7-5-6-14-9(7)8/h2-4H,5-6H2,1H3,(H,11,12) |
| InChIKey | KEBTYIZLERIQGP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate?
The IUPAC name of methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate (CID 110870856) is methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate.
What is the SMILES notation for methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate?
The canonical SMILES for methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate is COC(=O)Nc1cccc2c1OCC2.
What is the InChIKey of methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate?
The InChIKey is KEBTYIZLERIQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-13-10(12)11-8-4-2-3-7-5-6-14-9(7)8/h2-4H,5-6H2,1H3,(H,11,12).
What are the key properties of methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate?
methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate has a molecular weight of 193.20 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,3-dihydro-1-benzofuran-7-yl)carbamate is sourced from PubChem (CID 110870856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).