C16H16N4O3S — CID 110871668
5-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonyl-1,3-dihydrobenzimidazol-2-one (PubChem CID 110871668) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 5-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonyl-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonyl-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 110871668 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5-(2-pyridin-4-ylpyrrolidin-1-yl)sulfonyl-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N3CCCC3c3ccncc3)cc2[nH]1 |
| InChI | InChI=1S/C16H16N4O3S/c21-16-18-13-4-3-12(10-14(13)19-16)24(22,23)20-9-1-2-15(20)11-5-7-17-8-6-11/h3-8,10,15H,1-2,9H2,(H2,18,19,21) |
| InChIKey | QUKLRPJFNGOAFU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |