C8H14N2O3 — CID 110872096
N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]acetamide (PubChem CID 110872096) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]acetamide.
| Compound Name | N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110872096 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCCOC1=O |
| InChI | InChI=1S/C8H14N2O3/c1-7(11)9-3-5-10-4-2-6-13-8(10)12/h2-6H2,1H3,(H,9,11) |
| InChIKey | XORIKGKTBZTHEF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |