C26H28N2O3S — CID 1108722
2-[benzyl-(4-methylphenyl)sulfonylamino]-N-cyclopentylbenzamide (PubChem CID 1108722) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-cyclopentylbenzamide.
| Compound Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 1108722 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[benzyl-(4-methylphenyl)sulfonylamino]-N-cyclopentylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-20-15-17-23(18-16-20)32(30,31)28(19-21-9-3-2-4-10-21)25-14-8-7-13-24(25)26(29)27-22-11-5-6-12-22/h2-4,7-10,13-18,22H,5-6,11-12,19H2,1H3,(H,27,29) |
| InChIKey | IWRZBRHBXDFXTM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |