C15H13N3O2 — CID 110872518
furan-2-yl(1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-4-yl)methanone (PubChem CID 110872518) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is furan-2-yl(1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-4-yl)methanone.
| Compound Name | furan-2-yl(1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-4-yl)methanone |
|---|---|
| PubChem CID | 110872518 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | furan-2-yl(1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-4-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCc2nc3ccccn3c2C1 |
| InChI | InChI=1S/C15H13N3O2/c19-15(13-4-3-9-20-13)17-8-6-11-12(10-17)18-7-2-1-5-14(18)16-11/h1-5,7,9H,6,8,10H2 |
| InChIKey | SOFIZCUKMAQVHE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |