C12H8F3NS2 — CID 11087417
2,5,5-trifluoro-4-phenyl-2-prop-2-ynylsulfanyl-1,3-thiazole (PubChem CID 11087417) has the molecular formula C12H8F3NS2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 2,5,5-trifluoro-4-phenyl-2-prop-2-ynylsulfanyl-1,3-thiazole.
| Compound Name | 2,5,5-trifluoro-4-phenyl-2-prop-2-ynylsulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 11087417 |
| Molecular Formula | C12H8F3NS2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2,5,5-trifluoro-4-phenyl-2-prop-2-ynylsulfanyl-1,3-thiazole |
| SMILES | C#CCSC1(F)N=C(c2ccccc2)C(F)(F)S1 |
| InChI | InChI=1S/C12H8F3NS2/c1-2-8-17-12(15)16-10(11(13,14)18-12)9-6-4-3-5-7-9/h1,3-7H,8H2 |
| InChIKey | FOJPQHWQYAXTBI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|