C17H14N4O2 — CID 110874471
1-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)-3-phenylurea (PubChem CID 110874471) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)-3-phenylurea.
| Compound Name | 1-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)-3-phenylurea |
|---|---|
| PubChem CID | 110874471 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-(2-oxo-5-pyridin-4-yl-1H-pyridin-3-yl)-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cc(-c2ccncc2)c[nH]c1=O |
| InChI | InChI=1S/C17H14N4O2/c22-16-15(21-17(23)20-14-4-2-1-3-5-14)10-13(11-19-16)12-6-8-18-9-7-12/h1-11H,(H,19,22)(H2,20,21,23) |
| InChIKey | KXYXUKYOCMEUTD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |