C17H19N5 — CID 110874977
7-methyl-4-(4-phenylpiperazin-1-yl)pyrrolo[2,3-d]pyrimidine (PubChem CID 110874977) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 7-methyl-4-(4-phenylpiperazin-1-yl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-methyl-4-(4-phenylpiperazin-1-yl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 110874977 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 7-methyl-4-(4-phenylpiperazin-1-yl)pyrrolo[2,3-d]pyrimidine |
| SMILES | Cn1ccc2c(N3CCN(c4ccccc4)CC3)ncnc21 |
| InChI | InChI=1S/C17H19N5/c1-20-8-7-15-16(20)18-13-19-17(15)22-11-9-21(10-12-22)14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3 |
| InChIKey | HXJSLVIYUWHBMQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |