C20H20N4O3 — CID 110875288
3-amino-5a-methoxy-1-oxo-4-phenyl-4,6,7,8,9,9a-hexahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile (PubChem CID 110875288) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-amino-5a-methoxy-1-oxo-4-phenyl-4,6,7,8,9,9a-hexahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile.
| Compound Name | 3-amino-5a-methoxy-1-oxo-4-phenyl-4,6,7,8,9,9a-hexahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile |
|---|---|
| PubChem CID | 110875288 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-amino-5a-methoxy-1-oxo-4-phenyl-4,6,7,8,9,9a-hexahydrochromeno[3,4-c]pyrrole-3a,9b-dicarbonitrile |
| SMILES | COC12CCCCC1C1(C#N)C(=O)N=C(N)C1(C#N)C(c1ccccc1)O2 |
| InChI | InChI=1S/C20H20N4O3/c1-26-20-10-6-5-9-14(20)18(11-21)17(25)24-16(23)19(18,12-22)15(27-20)13-7-3-2-4-8-13/h2-4,7-8,14-15H,5-6,9-10H2,1H3,(H2,23,24,25) |
| InChIKey | BHFZTHMVTUOTMP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |