C19H17IN4O2 — CID 110875305
3,3,4-tricyano-8a-iodo-2-phenyl-2,4a,5,6,7,8-hexahydrochromene-4-carboxamide (PubChem CID 110875305) has the molecular formula C19H17IN4O2 and a molecular weight of 460.28 g/mol. Its IUPAC name is 3,3,4-tricyano-8a-iodo-2-phenyl-2,4a,5,6,7,8-hexahydrochromene-4-carboxamide.
| Compound Name | 3,3,4-tricyano-8a-iodo-2-phenyl-2,4a,5,6,7,8-hexahydrochromene-4-carboxamide |
|---|---|
| PubChem CID | 110875305 |
| Molecular Formula | C19H17IN4O2 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 3,3,4-tricyano-8a-iodo-2-phenyl-2,4a,5,6,7,8-hexahydrochromene-4-carboxamide |
| SMILES | N#CC1(C#N)C(c2ccccc2)OC2(I)CCCCC2C1(C#N)C(N)=O |
| InChI | InChI=1S/C19H17IN4O2/c20-19-9-5-4-8-14(19)18(12-23,16(24)25)17(10-21,11-22)15(26-19)13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-9H2,(H2,24,25) |
| InChIKey | OEHLGWRGSLLPFK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|