C29H40N4O2 — CID 110875499
N-(2-methoxy-5-methylphenyl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110875499) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110875499 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | COc1ccc(C)cc1NC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1Cc1cccnc1)[C@@H]23 |
| InChI | InChI=1S/C29H40N4O2/c1-21-12-13-27(35-2)25(17-21)31-28(34)11-3-10-26-24-9-6-16-32-15-5-8-23(29(24)32)20-33(26)19-22-7-4-14-30-18-22/h4,7,12-14,17-18,23-24,26,29H,3,5-6,8-11,15-16,19-20H2,1-2H3,(H,31,34)/t23-,24+,26+,29-/m0/s1 |
| InChIKey | BTJKAXLBJDDEID-ZICYKWEPSA-N |
| XLogP | 4.88 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |