About [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone
[(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone (PubChem CID 110875949) has the molecular formula C15H19FN2O2S
and a molecular weight of 310.39 g/mol. Its IUPAC name is [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone |
| PubChem CID | 110875949 |
| Molecular Formula | C15H19FN2O2S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@@H]1C[C@H](F)CN1C(=O)c1ccsc1)N1CCCCC1 |
| InChI | InChI=1S/C15H19FN2O2S/c16-12-8-13(15(20)17-5-2-1-3-6-17)18(9-12)14(19)11-4-7-21-10-11/h4,7,10,12-13H,1-3,5-6,8-9H2/t12-,13-/m0/s1 |
| InChIKey | VJQCNEVFRWOPHU-STQMWFEESA-N |
| XLogP | 2.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone?
The IUPAC name of [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone (CID 110875949) is [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone?
The canonical SMILES for [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone is O=C([C@@H]1C[C@H](F)CN1C(=O)c1ccsc1)N1CCCCC1.
What is the InChIKey of [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone?
The InChIKey is VJQCNEVFRWOPHU-STQMWFEESA-N. The full InChI is InChI=1S/C15H19FN2O2S/c16-12-8-13(15(20)17-5-2-1-3-6-17)18(9-12)14(19)11-4-7-21-10-11/h4,7,10,12-13H,1-3,5-6,8-9H2/t12-,13-/m0/s1.
What are the key properties of [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone?
[(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone has a molecular weight of 310.39 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-fluoro-1-(thiophene-3-carbonyl)pyrrolidin-2-yl]-piperidin-1-ylmethanone is sourced from PubChem (CID 110875949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).