C16H24OSSi — CID 11087634
trimethyl-[(2-phenylsulfanylcyclohex-3-en-1-yl)methoxy]silane (PubChem CID 11087634) has the molecular formula C16H24OSSi and a molecular weight of 292.52 g/mol. Its IUPAC name is trimethyl-[(2-phenylsulfanylcyclohex-3-en-1-yl)methoxy]silane.
| Compound Name | trimethyl-[(2-phenylsulfanylcyclohex-3-en-1-yl)methoxy]silane |
|---|---|
| PubChem CID | 11087634 |
| Molecular Formula | C16H24OSSi |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | trimethyl-[(2-phenylsulfanylcyclohex-3-en-1-yl)methoxy]silane |
| SMILES | C[Si](C)(C)OCC1CCC=CC1Sc1ccccc1 |
| InChI | InChI=1S/C16H24OSSi/c1-19(2,3)17-13-14-9-7-8-12-16(14)18-15-10-5-4-6-11-15/h4-6,8,10-12,14,16H,7,9,13H2,1-3H3 |
| InChIKey | GFNZKGBBUGFEDO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|