About triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane
triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane (PubChem CID 11087635) has the molecular formula C18H32OSi
and a molecular weight of 292.54 g/mol. Its IUPAC name is triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane.
Molecular Properties
| Compound Name | triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane |
| PubChem CID | 11087635 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane |
| SMILES | C=CCCCC(C#CC)(CC=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H32OSi/c1-7-13-14-17-18(15-8-2,16-9-3)19-20(10-4,11-5)12-6/h7-8H,1-2,10-15,17H2,3-6H3 |
| InChIKey | SWFXNPHHLQROCL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane?
The IUPAC name of triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane (CID 11087635) is triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane.
What is the SMILES notation for triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane?
The canonical SMILES for triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane is C=CCCCC(C#CC)(CC=C)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane?
The InChIKey is SWFXNPHHLQROCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32OSi/c1-7-13-14-17-18(15-8-2,16-9-3)19-20(10-4,11-5)12-6/h7-8H,1-2,10-15,17H2,3-6H3.
What are the key properties of triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane?
triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane has a molecular weight of 292.54 g/mol, XLogP of 5.70, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(4-prop-1-ynylnona-1,8-dien-4-yloxy)silane is sourced from PubChem (CID 11087635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).