C21H19FN4OS — CID 110876506
(2,4-dimethyl-1,3-thiazol-5-yl)-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone (PubChem CID 110876506) has the molecular formula C21H19FN4OS and a molecular weight of 394.48 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone.
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 110876506 |
| Molecular Formula | C21H19FN4OS |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[(1R,9S)-5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
| SMILES | Cc1nc(C)c(C(=O)N2[C@H]3CC[C@@H]2c2cnc(-c4ccc(F)cc4)nc2C3)s1 |
| InChI | InChI=1S/C21H19FN4OS/c1-11-19(28-12(2)24-11)21(27)26-15-7-8-18(26)16-10-23-20(25-17(16)9-15)13-3-5-14(22)6-4-13/h3-6,10,15,18H,7-9H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | TZIXHILKAFSWAT-MAUKXSAKSA-N |
| XLogP | 4.26 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |