C17H22N4O3 — CID 110876591
N-(2-methoxyethyl)-2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-2,3-dihydroindole-1-carboxamide (PubChem CID 110876591) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 110876591 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-(2-methoxyethyl)-2-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)-2,3-dihydroindole-1-carboxamide |
| SMILES | COCCNC(=O)N1c2ccccc2CC1c1noc(C(C)C)n1 |
| InChI | InChI=1S/C17H22N4O3/c1-11(2)16-19-15(20-24-16)14-10-12-6-4-5-7-13(12)21(14)17(22)18-8-9-23-3/h4-7,11,14H,8-10H2,1-3H3,(H,18,22) |
| InChIKey | HJKDJMIVYYMRMJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|