About N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide
N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide (PubChem CID 110876640) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide |
| PubChem CID | 110876640 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide |
| SMILES | CCNC(=O)c1c(C)oc2c1CN(C(=O)CC)CC2 |
| InChI | InChI=1S/C14H20N2O3/c1-4-12(17)16-7-6-11-10(8-16)13(9(3)19-11)14(18)15-5-2/h4-8H2,1-3H3,(H,15,18) |
| InChIKey | UXCNDCFHDFSQAV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide?
The IUPAC name of N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide (CID 110876640) is N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide.
What is the SMILES notation for N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide?
The canonical SMILES for N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide is CCNC(=O)c1c(C)oc2c1CN(C(=O)CC)CC2.
What is the InChIKey of N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide?
The InChIKey is UXCNDCFHDFSQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-4-12(17)16-7-6-11-10(8-16)13(9(3)19-11)14(18)15-5-2/h4-8H2,1-3H3,(H,15,18).
What are the key properties of N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide?
N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide has a molecular weight of 264.32 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methyl-5-propanoyl-6,7-dihydro-4H-furo[3,2-c]pyridine-3-carboxamide is sourced from PubChem (CID 110876640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).