C18H24N4O — CID 110876822
1-(cyclopropylmethyl)-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]urea (PubChem CID 110876822) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]urea.
| Compound Name | 1-(cyclopropylmethyl)-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]urea |
|---|---|
| PubChem CID | 110876822 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]urea |
| SMILES | CN1C(=CC=NNC(=O)NCC2CC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C18H24N4O/c1-18(2)14-6-4-5-7-15(14)22(3)16(18)10-11-20-21-17(23)19-12-13-8-9-13/h4-7,10-11,13H,8-9,12H2,1-3H3,(H2,19,21,23) |
| InChIKey | GFLCAFBMCQCFHM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|