About hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate
hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate (PubChem CID 110876881) has the molecular formula C12H14N2O3S
and a molecular weight of 266.32 g/mol. Its IUPAC name is hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate |
| PubChem CID | 110876881 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate |
| SMILES | CC=CC=CCOC(=O)c1csc(NC(C)=O)n1 |
| InChI | InChI=1S/C12H14N2O3S/c1-3-4-5-6-7-17-11(16)10-8-18-12(14-10)13-9(2)15/h3-6,8H,7H2,1-2H3,(H,13,14,15) |
| InChIKey | JNYBJOWYPKCNPS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate?
The IUPAC name of hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate (CID 110876881) is hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate.
What is the SMILES notation for hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate?
The canonical SMILES for hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate is CC=CC=CCOC(=O)c1csc(NC(C)=O)n1.
What is the InChIKey of hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate?
The InChIKey is JNYBJOWYPKCNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3S/c1-3-4-5-6-7-17-11(16)10-8-18-12(14-10)13-9(2)15/h3-6,8H,7H2,1-2H3,(H,13,14,15).
What are the key properties of hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate?
hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate has a molecular weight of 266.32 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-2,4-dienyl 2-acetamido-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 110876881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).