C15H22O4Si — CID 11087696
(1R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-6,10-dioxatricyclo[6.2.1.04,9]undeca-3,8(11)-dien-5-one (PubChem CID 11087696) has the molecular formula C15H22O4Si and a molecular weight of 294.42 g/mol. Its IUPAC name is (1R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-6,10-dioxatricyclo[6.2.1.04,9]undeca-3,8(11)-dien-5-one.
| Compound Name | (1R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-6,10-dioxatricyclo[6.2.1.04,9]undeca-3,8(11)-dien-5-one |
|---|---|
| PubChem CID | 11087696 |
| Molecular Formula | C15H22O4Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (1R,9R)-3-[tert-butyl(dimethyl)silyl]oxy-6,10-dioxatricyclo[6.2.1.04,9]undeca-3,8(11)-dien-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C2C(=O)OCC3=C[C@@H](C1)O[C@H]32 |
| InChI | InChI=1S/C15H22O4Si/c1-15(2,3)20(4,5)19-11-7-10-6-9-8-17-14(16)12(11)13(9)18-10/h6,10,13H,7-8H2,1-5H3/t10-,13+/m0/s1 |
| InChIKey | XOGDRSZUJZHLHH-GXFFZTMASA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|