C13H26O3S2 — CID 11087700
(2S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-bis(ethylsulfanyl)butan-2-ol (PubChem CID 11087700) has the molecular formula C13H26O3S2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (2S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-bis(ethylsulfanyl)butan-2-ol.
| Compound Name | (2S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-bis(ethylsulfanyl)butan-2-ol |
|---|---|
| PubChem CID | 11087700 |
| Molecular Formula | C13H26O3S2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-bis(ethylsulfanyl)butan-2-ol |
| SMILES | CCSC(SCC)[C@@H](O)CC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H26O3S2/c1-5-17-12(18-6-2)11(14)8-7-10-9-15-13(3,4)16-10/h10-12,14H,5-9H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | UCPPBIMHEYOQTQ-MNOVXSKESA-N |
| XLogP | 3.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|